CymitQuimica logo

CAS 6339-54-4

:

1-methyl-4-nitro-1H-imidazole-5-thiol

Description:
1-Methyl-4-nitro-1H-imidazole-5-thiol is a heterocyclic organic compound characterized by its imidazole ring, which contains both a methyl group and a nitro group as substituents. The presence of the thiol (-SH) functional group at the 5-position of the imidazole ring imparts unique chemical properties, including the ability to form disulfide bonds and participate in redox reactions. This compound is typically a yellow to orange solid and is soluble in polar solvents due to the presence of the thiol group. It exhibits potential biological activity, making it of interest in medicinal chemistry and biochemistry. The nitro group can influence the compound's reactivity and stability, while the methyl group may affect its lipophilicity. Overall, 1-methyl-4-nitro-1H-imidazole-5-thiol is a versatile compound with applications in various fields, including pharmaceuticals and materials science, due to its unique structural features and reactivity.
Formula:C4H5N3O2S
InChI:InChI=1/C4H5N3O2S/c1-6-2-5-3(4(6)10)7(8)9/h2,10H,1H3
SMILES:Cn1cnc(c1S)N(=O)=O
Synonyms:
  • 1H-imidazole-5-thiol, 1-methyl-4-nitro-
  • 1-Methyl-4-nitro-1H-imidazole-5-thiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.