CAS 63399-38-2

2-Pentenoic acid, 5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methyl-, [1S-(1α,4aβ,6α,8aα)]-

Description:

2-Pentenoic acid, 5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methyl-, with the CAS number 63399-38-2, is a complex organic compound characterized by its unique structural features. It contains a pentenoic acid moiety, indicating the presence of a carboxylic acid group (-COOH) attached to a five-carbon chain with a double bond. The compound also features a naphthalene derivative, which contributes to its aromatic properties and potential biological activity. The presence of multiple methyl groups and a hydroxy group suggests that it may exhibit hydrophobic characteristics, while the double bond in the pentenoic acid portion can participate in various chemical reactions, such as addition or polymerization. This compound may be of interest in fields such as organic synthesis, pharmaceuticals, or materials science due to its structural complexity and potential reactivity. However, specific applications and biological activities would require further investigation and characterization.

Formula: C₂₀H₃₂O₃

InChI: InChI=1S/C20H32O3/c1-13(12-18(22)23)6-8-15-14(2)7-9-16-19(3,4)17(21)10-11-20(15,16)5/h12,15-17,21H,2,6-11H2,1,3-5H3,(H,22,23)/t15-,16-,17-,20+/m0/s1

InChI key: InChIKey=LNWOKEZJIRLIDO-OGNFBWPZSA-N

SMILES: C[C@@]12[C@](C(C)(C)[C@@H](O)CC1)(CCC(=C)[C@@H]2CCC(=CC(O)=O)C)[H]

Synonyms:

• 2-Pentenoic acid, 5-(decahydro-6-hydroxy-5,5,8a-trimethyl-2-methylene-1-naphthalenyl)-3-methyl-, [1S-(1α,4aβ,6α,8aα)]-

Alepterolic acid

CAS: 63399-38-2

Formula: C₂₀H₃₂O₃

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 320.4663

Ref: IN-DA00EGTC

Alepterolic acid

CAS: 63399-38-2

Alepterolic acid exhibits larvicidal properties against Aedes aegypti (L.) (Diptera, Culicidae), with LC50 of 87.3 ppm.

Formula: C₂₀H₃₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 320.473

Ref: TM-TN3374

Alepterolic acid

CAS: 63399-38-2

Formula: C₂₀H₃₂O₃

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 320.473

Ref: BP-SBP00727

Alepterolic acid

CAS: 63399-38-2

Alepterolic acid is a naturally occurring fungal metabolite, which is isolated from certain species of fungi known for producing various bioactive compounds. As a bioactive compound, it functions by inhibiting the enzyme squalene epoxidase, a critical enzyme in the cholesterol biosynthesis pathway. This enzymatic inhibition results in reducing cholesterol levels, demonstrating potential therapeutic applications in managing hypercholesterolemia.

Formula: C₂₀H₃₂O₃

Purity: Min. 95%

Molecular weight: 320.5 g/mol

Ref: 3D-NCA39938