CAS 6340-52-9
:methyl 6-deoxy-B-D-glucopyranoside
Description:
Methyl 6-deoxy-β-D-glucopyranoside is a carbohydrate derivative characterized by its structure, which includes a glucopyranose ring with a methyl ether group at the anomeric carbon and a deoxy group at the 6-position. This compound is a sugar alcohol and is typically white to off-white in appearance, soluble in water due to its hydroxyl groups, and exhibits sweet taste characteristics. It is often used in biochemical research and as a building block in the synthesis of more complex carbohydrates and glycosides. The presence of the methyl group enhances its stability and alters its reactivity compared to its parent sugar. Methyl 6-deoxy-β-D-glucopyranoside can participate in various chemical reactions, including glycosylation, making it valuable in organic synthesis and medicinal chemistry. Its CAS number, 6340-52-9, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, this compound plays a significant role in the study of carbohydrate chemistry and its applications in various fields.
Formula:C7H14O5
InChI:InChI=1/C7H14O5/c1-3-4(8)5(9)6(10)7(11-2)12-3/h3-10H,1-2H3/t3-,4+,5+,6-,7-/m1/s1
Synonyms:- methyl 6-deoxy-β-D-galactopyranoside
- methyl-6-desoxy-β-D-glucopyranoside
- methyl 6-deoxy-B-D-glucopyranoside
- Methyl 6-deoxy-beta-D-glucoside
- methyl 6-deoxy-β-d-glucopyranoside
- Methyl 6-deoxy-β-D-glucopyranoside
- β-D-Glucopyranoside, methyl 6-deoxy-
- Methyl 6-deoxy-β-D-glucopyranoside ,98%
- METHYL 6-DEOXY-BETA-D-GLUCOPYRANOSIDE
- (2R,3R,4S,5S,6R)-2-methoxy-6-methyltetrahydro-2H-pyran-3,4,5-triol
- Nsc51241
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 6-deoxy-β-D-glucopyranoside
CAS:Methyl 6-deoxy-β-D-glucopyranosidePurity:98%Molecular weight:178.18g/molMethyl 6-deoxy-β-D-glucopyranoside
CAS:Methyl 6-deoxy-b-D-glucopyranoside is a custom synthesis that produces methylated sugars. It is a high purity, complex carbohydrate with a molecular weight of 312.06 g/mol and CAS No. 6340-52-9. Methyl 6-deoxy-b-D-glucopyranoside is produced by the click modification of glucose, which is an oligosaccharide composed of six molecules of glucose linked together. This product has been used in the synthesis of polysaccharides and saccharides.
Formula:C7H14O5Purity:Min. 95%Color and Shape:PowderMolecular weight:178.18 g/mol


