
CAS 6340-55-2
:(5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-en-1-ylphenyl)methylidene]-1-(4-ethoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione
Description:
The chemical substance with the name "(5E)-5-[(3-ethoxy-4-hydroxy-5-prop-2-en-1-ylphenyl)methylidene]-1-(4-ethoxyphenyl)pyrimidine-2,4,6(1H,3H,5H)-trione" and CAS number 6340-55-2 is a complex organic compound characterized by its pyrimidine core, which is substituted at various positions with ethoxy and phenyl groups. This compound features a conjugated system due to the presence of the prop-2-en-1-yl moiety, contributing to its potential reactivity and biological activity. The hydroxyl group on the phenyl ring may impart additional polar characteristics, influencing solubility and interaction with biological targets. The presence of multiple functional groups suggests that this compound could exhibit diverse pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity may also lead to unique optical properties, which could be explored in various applications, including drug development and material science. Overall, this compound exemplifies the intricate relationship between molecular structure and potential functionality in chemical and biological contexts.
Formula:C24H24N2O6
InChI:InChI=1/C24H24N2O6/c1-4-7-16-12-15(14-20(21(16)27)32-6-3)13-19-22(28)25-24(30)26(23(19)29)17-8-10-18(11-9-17)31-5-2/h4,8-14,27H,1,5-7H2,2-3H3,(H,25,28,30)/b19-13+
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,6-DIMETHOXY-4-METHYLQUINOLINE
CAS:Formula:C11H10ClNOPurity:98%Color and Shape:SolidMolecular weight:207.65622-Chloro-6-methoxy-4-methyl-quinoline
CAS:2-Chloro-6-methoxy-4-methyl-quinolineFormula:C11H10ClNOPurity:95%Color and Shape: light pink powderMolecular weight:207.65619g/mol2-Chloro-6-methoxy-4-methylquinoline
CAS:Controlled ProductApplications 2-Chloro-6-methoxy-4-methylquinoline is an intermediate in the synthesis of Tafenoquine-d3 Succinate which is the labelled analog of Tatenoquine (T004760), a new 8-aminoquinoline with an improved therapeutic index and safety profile as compared to primaquine (P733500).Tafenoquine has the potential to become a widely used drug in the prevention and treatment of malaria infection and could replace some currently used drugs as resistant strains of Plasmodium species increase.
References McIntyre, J. A., et al.: Drugs. Future., 28, 859 (2003); LaMontagne, M.P., et al.: J. Medn. Chem., 32, 1728 (1989);Formula:C11H10ClNOColor and Shape:NeatMolecular weight:207.66




