CymitQuimica logo

CAS 63401-08-1

:

N-ethyl-1-hydroxy-1-phenylpropan-2-aminium chloride

Description:
N-ethyl-1-hydroxy-1-phenylpropan-2-aminium chloride, with the CAS number 63401-08-1, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features an ethyl group and a phenyl group attached to a propan-2-aminium backbone, along with a hydroxyl group that contributes to its solubility in polar solvents. As a quaternary ammonium salt, it typically exhibits surfactant properties, making it useful in various applications, including as a disinfectant, emulsifier, or in formulations for personal care products. The chloride ion serves as the counterion, enhancing its stability and solubility in aqueous solutions. Its structure allows for potential interactions with biological membranes, which can influence its bioactivity and efficacy in different contexts. Overall, N-ethyl-1-hydroxy-1-phenylpropan-2-aminium chloride is notable for its versatility in chemical applications, particularly in the fields of pharmaceuticals and materials science.
Formula:C11H18ClNO
InChI:InChI=1/C11H17NO.ClH/c1-3-12-9(2)11(13)10-7-5-4-6-8-10;/h4-9,11-13H,3H2,1-2H3;1H
SMILES:CCNC(C)C(c1ccccc1)O.Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.