CAS 6341-93-1

6-Acetyl-2,4(1H,3H)-pyrimidinedione

Description:

6-Acetyl-2,4(1H,3H)-pyrimidinedione, also known as 6-acetyluracil, is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains two carbonyl groups and an acetyl substituent. This compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and ethanol, owing to its polar functional groups. It exhibits tautomerism, existing in equilibrium between its keto and enol forms, which can influence its reactivity and interactions in biological systems. The presence of the acetyl group enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, 6-acetyl-2,4(1H,3H)-pyrimidinedione has been studied for its biological activities, including potential antimicrobial and antitumor properties. Its unique structure allows it to participate in various biochemical pathways, making it of interest in medicinal chemistry and drug development.

Formula: C₆H₆N₂O₃

InChI: InChI=1S/C6H6N2O3/c1-3(9)4-2-5(10)8-6(11)7-4/h2H,1H3,(H2,7,8,10,11)

InChI key: InChIKey=CKJBKWWHBKLNPB-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=CC(=O)NC(=O)N1

Synonyms:

• 2,4(1H,3H)-Pyrimidinedione, 6-acetyl-
• 6-Acetyl-2,4(1H,3H)-pyrimidinedione
• Uracil, 6-acetyl-
• NSC 48610
• 6-Acetyluracil

6-Acetyl-1,2,3,4-tetrahydropyrimidine-2,4-dione

CAS: 6341-93-1

6-Acetyl-1,2,3,4-tetrahydropyrimidine-2,4-dione is a chemical compound that has two functions. One function is as a dianion that can be used to measure the hydrogen ion concentration in an aqueous solution with the pH range of 1 to 14. The second function is as an acid complex with constant K1 and K2 values. This compound is stable in the presence of acids and bases and can react with alcohols to form esters. 6-Acetyl-1,2,3,4-tetrahydropyrimidine-2,4-dione has been used in the synthesis of orotic acid from orotic acid esters.

Formula: C₆H₆N₂O₃

Purity: Min. 95%

Molecular weight: 154.12 g/mol

Ref: 3D-GAA34193