CAS 63413-91-2
:3-(phenylthio)acrylic acid, mixture of cis A
Description:
3-(Phenylthio)acrylic acid, with the CAS number 63413-91-2, is an organic compound characterized by the presence of both an acrylic acid moiety and a phenylthio group. This compound typically exhibits a double bond between the carbon atoms in the acrylic acid structure, which contributes to its reactivity, particularly in addition reactions. The phenylthio group enhances the compound's lipophilicity and can influence its solubility in organic solvents. The mixture of cis isomers indicates that the compound exists in different geometric forms, which can affect its physical properties, such as melting point and boiling point, as well as its reactivity and interaction with biological systems. Generally, compounds like this may be used in various applications, including organic synthesis and as intermediates in the production of pharmaceuticals or agrochemicals. The presence of both functional groups allows for diverse chemical reactivity, making it a valuable compound in synthetic organic chemistry.
Formula:C9H8O2S
InChI:InChI=1/C9H8O2S/c10-9(11)6-7-12-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+
Synonyms:- 3-(Phenylthio)acrylic acid,mixture of cis and trans
- (2E)-3-(phenylsulfanyl)prop-2-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-(Phenylthio)acrylic Acid
CAS:Controlled ProductApplications 3-(Phenylthio)acrylic Acid (cas# 63413-91-2) is a useful research chemical.
Formula:C9H8O2SColor and Shape:Light BrownMolecular weight:180.224

