CAS 634151-15-8

4-(3,5-dibromo-4-methoxybenzyl)-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5(6H)-one

Description:

4-(3,5-Dibromo-4-methoxybenzyl)-6-methyl-2-(methylamino)imidazo[4,5-d]azepin-5(6H)-one is a complex organic compound characterized by its imidazoazepine core structure, which incorporates both aromatic and heterocyclic features. The presence of bromine substituents enhances its reactivity and may influence its biological activity, while the methoxy group contributes to its lipophilicity and potential interactions with biological targets. The methylamino group suggests possible interactions with neurotransmitter systems, indicating potential pharmacological applications. This compound is likely to exhibit moderate to high solubility in organic solvents, with varying solubility in water, depending on the pH and the presence of other solubilizing agents. Its molecular structure suggests potential for diverse chemical reactivity, making it a candidate for further research in medicinal chemistry. As with many compounds of this nature, safety and handling precautions are essential due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₇H₁₆Br₂N₄O₂

InChI: InChI=1/C17H16Br2N4O2/c1-20-17-21-13-4-5-23(2)16(24)10(14(13)22-17)6-9-7-11(18)15(25-3)12(19)8-9/h4-5,7-8H,6H2,1-3H3,(H,20,22)

SMILES: CN=c1nc2ccn(C)c(=O)c(Cc3cc(c(c(c3)Br)OC)Br)c2[nH]1

Ceratamine A

CAS: 634151-15-8

Ceratamine A, from Pseudoceratina sponge, is a cytotoxic, microtubule-stabilizing antimitotic alkaloid.

Formula: C₁₇H₁₆Br₂N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 468.14

Ref: TM-T10763

Ceratamine A

Controlled Product

CAS: 634151-15-8

Formula: C₁₇H₁₆Br₂N₄O₂

Color and Shape: Neat

Molecular weight: 468.14

Ref: TR-C265500