CymitQuimica logo

CAS 634196-64-8

:

4,4,5,5-Tetramethyl-2-[2-(2-thienyl)ethynyl]-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-[2-(2-thienyl)ethynyl]-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a boron atom bonded to two oxygen atoms in a cyclic arrangement. This compound contains a thienyl group, which is a five-membered aromatic ring containing sulfur, and an ethynyl group, contributing to its reactivity and potential applications in organic synthesis and materials science. The presence of the tetramethyl substituents enhances its solubility and stability, making it suitable for various chemical reactions, including cross-coupling reactions commonly used in the formation of carbon-carbon bonds. Its boron-containing structure also suggests potential utility in the development of boron-based reagents or catalysts. Additionally, the compound's unique electronic properties may be exploited in organic electronics or photonic applications. Overall, 4,4,5,5-Tetramethyl-2-[2-(2-thienyl)ethynyl]-1,3,2-dioxaborolane is a versatile compound with significant implications in synthetic organic chemistry and materials development.
Formula:C12H15BO2S
InChI:InChI=1S/C12H15BO2S/c1-11(2)12(3,4)15-13(14-11)8-7-10-6-5-9-16-10/h5-6,9H,1-4H3
InChI key:InChIKey=AXPMFQSZPYQNEJ-UHFFFAOYSA-N
SMILES:C(#CC1=CC=CS1)B2OC(C)(C)C(C)(C)O2
Synonyms:
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(2-thienylethynyl)-
  • 4,4,5,5-Tetramethyl-2-[2-(2-thienyl)ethynyl]-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-(2-thienyl)ethynyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.