CAS 6342-21-8
:N1,N1-Dimethyl-1-phenyl-1,2-ethanediamine
Description:
N1,N1-Dimethyl-1-phenyl-1,2-ethanediamine, with the CAS number 6342-21-8, is an organic compound characterized by its amine functional groups. It features a phenyl group attached to a central ethane backbone, which is further substituted with two methyl groups on one nitrogen atom. This structure imparts both hydrophilic and hydrophobic characteristics, making it soluble in various organic solvents while exhibiting limited solubility in water. The compound is primarily used in chemical synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its amine groups can participate in various chemical reactions, including alkylation and acylation, making it a versatile building block in organic chemistry. Additionally, due to the presence of the dimethylamino group, it may exhibit basic properties, allowing it to interact with acids to form salts. Safety data indicates that, like many amines, it should be handled with care, as it may cause irritation to the skin and eyes. Proper safety protocols should be followed when working with this compound.
Formula:C10H16N2
InChI:InChI=1/C10H16N2/c1-12(2)10(8-11)9-6-4-3-5-7-9/h3-7,10H,8,11H2,1-2H3
SMILES:CN(C)C(CN)c1ccccc1
Synonyms:- 1,2-ethanediamine, N~1~,N~1~-dimethyl-1-phenyl-
- N~1~,N~1~-dimethyl-1-phenylethane-1,2-diamine
- N-(2-Dimethylamino-2-phenylethyl)amine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N1,N1-Dimethyl-1-phenyl-1,2-ethanediamine, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H16N2Purity:98%Molecular weight:164.25N1,N1-Dimethyl-1-phenylethane-1,2-diamine
CAS:<p>N1,N1-Dimethyl-1-phenylethane-1,2-diamine</p>Formula:C10H16N2Purity:≥95%Color and Shape: yellow liquidMolecular weight:164.25g/molN*1*,N*1*-Dimethyl-1-phenyl-ethane-1,2-diamine
CAS:Formula:C10H16N2Purity:97%Color and Shape:LiquidMolecular weight:164.252




