CAS 6342-60-5
:2-Chloro-5-methylbenzoic acid
Description:
2-Chloro-5-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a chlorine atom and a methyl group on a benzoic acid structure. The chlorine atom is located at the second position, while the methyl group is at the fifth position of the benzene ring, which influences its chemical reactivity and physical properties. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the chlorine atom can enhance its reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.
Formula:C8H7ClO2
InChI:InChI=1S/C8H7ClO2/c1-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=LEBWXJZAWTVKFL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(Cl)C=CC(C)=C1
Synonyms:- 2-Chloro-5-Methylbenzoate
- 2-Chloro-5-Methylbenzole Acid
- Benzoic acid, 2-chloro-5-methyl-
- NSC 46623
- m-Toluic acid, 6-chloro-
- 2-Chloro-5-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Chloro-5-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:SolidMolecular weight:170.59302-Chloro-5-methylbenzoic acid
CAS:2-Chloro-5-methylbenzoic acidFormula:C8H7ClO2Purity:≥95%Color and Shape: white solidMolecular weight:170.59g/mol2-Chloro-5-methylbenzoic acid
CAS:2-Chloro-5-methylbenzoic acid is a carcinogenic substance that is used in the manufacturing of acridine dyes. It can be found in both solid and liquid forms and has an experimental solubility range of 0.01 to 1.0g/100ml at 25°C. 2-Chloro-5-methylbenzoic acid is soluble in water and has a solute activity coefficient of 1.2, which means it is fairly soluble in water. This chemical also exhibits high reactivity with other compounds that are dissolved in water. The chemical reacts with hydrogen sulfide to produce sulfur dioxide gas, ammonia, and hydrochloric acid, as well as with nitric oxide to produce nitrous oxide, nitrogen dioxide gas, and nitric acid.Formula:C8H7ClO2Purity:Min. 95%Color and Shape:PowderMolecular weight:170.59 g/mol2-Chloro-5-methylbenzoic acid
CAS:Formula:C8H7ClO2Purity:97%Color and Shape:SolidMolecular weight:170.59



