CAS 6342-72-9

dimethyl 2-hydroxybenzene-1,4-dicarboxylate

Description:

Dimethyl 2-hydroxybenzene-1,4-dicarboxylate, commonly known as dimethyl 2-hydroxyterephthalate, is an organic compound characterized by its structure, which includes two carboxylate groups and a hydroxyl group attached to a benzene ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the hydroxyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including esterification and condensation. Dimethyl 2-hydroxybenzene-1,4-dicarboxylate is often used in the synthesis of polymers, pharmaceuticals, and as an intermediate in organic synthesis. Its properties make it valuable in applications requiring specific chemical functionalities, such as in the production of plasticizers or as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₀H₁₀O₅

InChI: InChI=1/C10H10O5/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5,11H,1-2H3

SMILES: COC(=O)c1ccc(c(c1)O)C(=O)OC

Synonyms:

• Dimethyl 2-Hydroxyterephthalate

Dimethyl 2-hydroxyterephthalate

CAS: 6342-72-9

Formula: C₁₀H₁₀O₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 210.1834

Ref: IN-DA00EAI2

Dimethyl 2-hydroxyterephthalate

CAS: 6342-72-9

Dimethyl 2-hydroxyterephthalate

Formula: C₁₀H₁₀O₅

Purity: 99%

Color and Shape: white solid

Molecular weight: 210.18g/mol

Ref: 54-OR6979

2-Hydroxy-terephthalic acid dimethyl ester

CAS: 6342-72-9

Formula: C₁₀H₁₀O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.185

Ref: 10-F047390