CAS 63424-42-0
:N-[2-(β-D-Galactopyranosyloxy)-5-nitrophenyl]hexadecanamide
Description:
N-[2-(β-D-Galactopyranosyloxy)-5-nitrophenyl]hexadecanamide, with the CAS number 63424-42-0, is a chemical compound characterized by its complex structure, which includes a long-chain fatty acid amide linked to a nitrophenyl group and a galactopyranosyl moiety. This compound typically exhibits amphiphilic properties due to the presence of both hydrophilic (sugar) and hydrophobic (fatty acid) components, making it potentially useful in various applications such as drug delivery systems and surfactants. The nitrophenyl group may impart specific electronic properties, influencing its reactivity and interaction with biological systems. Additionally, the galactopyranosyl unit can facilitate interactions with biological receptors, enhancing its potential for targeting specific cells or tissues. The compound's stability, solubility, and biological activity can vary based on environmental conditions and the presence of other substances. Overall, this compound represents a unique intersection of organic chemistry and biochemistry, with potential implications in pharmaceutical and biotechnological fields.
Formula:C28H46N2O9
InChI:InChI=1/C28H46N2O9/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-24(32)29-21-18-20(30(36)37)16-17-22(21)38-28-27(35)26(34)25(33)23(19-31)39-28/h16-18,23,25-28,31,33-35H,2-15,19H2,1H3,(H,29,32)/t23-,25+,26+,27-,28-/m1/s1
InChI key:InChIKey=VQANZNCUHNPTGV-FWZZJMFBSA-N
SMILES:O(C1=C(NC(CCCCCCCCCCCCCCC)=O)C=C(N(=O)=O)C=C1)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O
Synonyms:- 2-Hexadecanoylamino-4-nitrophenyl β-<span class="text-smallcaps">D</span>-galactopyranoside
- 2-Hexadecanoylamino-4-nitrophenyl-beta-D-galactopyranoside
- Hexadecanamide, N-(2-(beta-D-galactopyranosyloxy)-5-nitrophenyl)-
- Hexadecanamide, N-[2-(β-<span class="text-smallcaps">D</span>-galactopyranosyloxy)-5-nitrophenyl]-
- N-(2-(beta-D-Galactopyranosyloxy)-5-nitrophenyl)palmitamide
- N-[2-(beta-D-galactopyranosyloxy)-5-nitrophenyl]hexadecanamide
- N-[2-(β-<span class="text-smallcaps">D</span>-Galactopyranosyloxy)-5-nitrophenyl]hexadecanamide
- 2-Hexadecanoylamino-4-nitrophenyl β-D-galactopyranoside
- N-[2-(β-D-Galactopyranosyloxy)-5-nitrophenyl]hexadecanamide
- Hexadecanamide, N-[2-(β-D-galactopyranosyloxy)-5-nitrophenyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2’-(N-Hexadecanoylamino)-4’-nitrophenyl-β-D-galactopyranoside
CAS:<p>2’-(N-Hexadecanoylamino)-4’-nitrophenyl-b-D-galactopyranoside is a synthetic substrate that is used to diagnose and monitor brain diseases. It can be used in the diagnosis of Alzheimer's disease by measuring the amount of amniotic fluid that leaks into the brain. The rate of hydrolysis of this substrate has been shown to be higher in patients with Alzheimer's disease than in healthy controls. This synthetic substrate is also useful for monitoring the activity of taurocholate galactohydrolase, which is an enzyme that breaks down bile salts and plays a role in cholesterol metabolism. The rate of hydrolysis has been found to be increased in patients with Parkinson's disease, but not in those with Alzheimer's disease or healthy controls. 2’-(N-Hexadecanoylamino)-4’-nitrophenyl-b-D-galactop</p>Formula:C28H46N2O9Purity:Min. 95%Color and Shape:PowderMolecular weight:554.67 g/mol2-Hexadecanoylamino-4-nitrophenyl β-D-Galactopyranoside
CAS:Controlled ProductFormula:C28H46N2O9Color and Shape:NeatMolecular weight:554.673

