CAS 6343-86-8
:5-Chloro-2,1,3-benzoselenadiazole
Description:
5-Chloro-2,1,3-benzoselenadiazole is an organic compound characterized by its unique structure, which includes a selenadiazole ring fused to a benzene ring, along with a chlorine substituent at the 5-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential aromaticity due to the presence of the benzene ring. The presence of selenium in the selenadiazole moiety can impart distinct chemical reactivity, particularly in redox reactions, and may influence its biological activity. The chlorine atom can enhance the compound's lipophilicity and may affect its interaction with biological targets. 5-Chloro-2,1,3-benzoselenadiazole is of interest in various fields, including materials science and medicinal chemistry, due to its potential applications in the development of pharmaceuticals and agrochemicals. Its synthesis and reactivity can be influenced by the electronic properties of the substituents and the overall molecular structure, making it a subject of study for researchers exploring new chemical entities.
Formula:C6H3ClN2Se
InChI:InChI=1/C6H3ClN2Se/c7-4-1-2-5-6(3-4)9-10-8-5/h1-3H
InChI key:InChIKey=CTMDEMMDWLZMIP-UHFFFAOYSA-N
SMILES:ClC1=CC=2C(C=C1)=N[Se]N2
Synonyms:- 2,1,3-Benzoselenadiazole, 5-Chloro-
- 5-Chloropiazselenol
- 5-Chloropiazselenole
- NSC 49767
- 5-Chloro-2,1,3-benzoselenadiazole
- 5-Chloro-2,1,3-benzoselenadiazole
- 5-Chloro- 2,1,3-benzoselena(SeIV)diazole
- 5-Chloro-2,1,3-benzoselenadiazole-2-SeIV
- 6-CHLORO-2,1,3-BENZOSELENADIAZOLE
- ZERENEX E/6022212
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-2,1,3-benzoselenadiazole
CAS:Controlled ProductApplications 6-Chloro-2,1,3-benzoselenadiazole (cas# 6343-86-8) is a compound useful in organic synthesis.
Formula:C6H3ClN2SeColor and Shape:NeatMolecular weight:217.51
