CAS 6344-05-4
:4-Chloroisatin
Description:
4-Chloroisatin is an organic compound characterized by its structure, which includes a chloro substituent on the isatin framework. It features a fused bicyclic system comprising a benzene ring and a lactam, specifically a 1H-indole-2,3-dione structure. The presence of the chlorine atom at the 4-position of the benzene ring influences its chemical reactivity and properties, making it a valuable intermediate in organic synthesis. 4-Chloroisatin is typically a solid at room temperature and is known for its potential biological activities, including antimicrobial and anticancer properties. It is soluble in organic solvents like ethanol and dimethyl sulfoxide, but its solubility in water is limited. The compound can undergo various chemical reactions, such as nucleophilic substitutions and cycloadditions, which are of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H4ClNO2
InChI:InChI=1/C8H4ClNO2/c9-4-2-1-3-5-6(4)7(11)8(12)10-5/h1-3H,(H,10,11,12)
SMILES:c1cc(c2c(c1)NC(=O)C2=O)Cl
Synonyms:- Indole-2,3-dione, 4-chloro-
- 4-Chloroindole-2,3-dione
- 4-chloro-1H-indole-2,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloroisatin
CAS:Formula:C8H4ClNO2Purity:>97.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:181.584-Chloroisatin
CAS:4-Chloroisatin is a chemical compound that belongs to the group of ring-opening reactions. It has been shown to be an efficient method for the synthesis of nitrogen-containing heterocycles. This reaction mechanism involves the formation of a reactive intermediate, which reacts with amines to form a nitrogen atom and an actinomycetes molecule. The regiospecificity of this reaction can be controlled by altering the substrate or solvent. 4-Chloroisatin has also shown biological properties in cancer cells, which may be due to its inhibition of protein synthesis through inhibition of RNA and DNA synthesis.
Formula:C8H4O2NClPurity:Min. 95%Color and Shape:PowderMolecular weight:181.58 g/mol4-Chloroisatin
CAS:Formula:C8H4ClNO2Purity:95%Color and Shape:Yellow to deep reddish yellow powderMolecular weight:181.58





