CAS 6344-17-8
:(6E)-6-(1,3-benzothiazol-2(3H)-ylidene)-4-bromocyclohexa-2,4-dien-1-one
Description:
The chemical substance known as (6E)-6-(1,3-benzothiazol-2(3H)-ylidene)-4-bromocyclohexa-2,4-dien-1-one, with the CAS number 6344-17-8, is a complex organic compound characterized by its unique structural features. It contains a cyclohexadienone core, which is a six-membered ring with alternating double bonds and a ketone functional group, contributing to its reactivity and stability. The presence of a bromine atom enhances its electrophilic properties, making it useful in various chemical reactions. Additionally, the benzothiazole moiety introduces heteroatoms into the structure, which can influence its electronic properties and potential biological activity. This compound may exhibit interesting optical properties due to its conjugated system, making it a candidate for applications in organic electronics or as a dye. Its synthesis and characterization are of interest in the field of organic chemistry, particularly in the development of novel materials or pharmaceuticals. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.
Formula:C13H8BrNOS
InChI:InChI=1/C13H8BrNOS/c14-8-5-6-11(16)9(7-8)13-15-10-3-1-2-4-12(10)17-13/h1-7,15H/b13-9+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2-Benzothiazolyl)-4-bromo-phenol
CAS:Controlled ProductFormula:C13H8BrNOSColor and Shape:NeatMolecular weight:306.178
