CAS 6344-77-0

2-(benzylsulfanyl)quinazolin-4(1H)-one

Description:

2-(Benzylsulfanyl)quinazolin-4(1H)-one is a chemical compound characterized by its quinazolinone core, which is a bicyclic structure containing both a benzene and a pyrimidine ring. This compound features a benzylsulfanyl group, which introduces a sulfur atom bonded to a benzyl moiety, enhancing its potential for various chemical interactions. The presence of the sulfanyl group can influence the compound's reactivity and solubility, making it of interest in medicinal chemistry and drug design. Typically, compounds like this may exhibit biological activity, potentially serving as leads in the development of pharmaceuticals. The molecular structure contributes to its properties, including melting point, solubility, and stability under various conditions. Additionally, the compound's CAS number, 6344-77-0, allows for easy identification and retrieval of information in chemical databases. Overall, 2-(benzylsulfanyl)quinazolin-4(1H)-one represents a unique scaffold that may be explored for its therapeutic potential and chemical versatility.

Formula: C₁₅H₁₂N₂OS

InChI: InChI=1/C15H12N2OS/c18-14-12-8-4-5-9-13(12)16-15(17-14)19-10-11-6-2-1-3-7-11/h1-9H,10H2,(H,16,17,18)

SMILES: c1ccc(cc1)CSc1nc2ccccc2c(n1)O

Synonyms:

• 2-(Benzylsulfanyl)quinazolin-4(3H)-one
• 4(1H)-quinazolinone, 2-[(phenylmethyl)thio]-
• 4(3H)-Quinazolinone, 2-[(phenylmethyl)thio]-
• 4-Quinazolinol, 2-[(Phenylmethyl)Thio]-

2-(phenylmethylthio)-3-hydroquinazolin-4-one

CAS: 6344-77-0

Please enquire for more information about 2-(phenylmethylthio)-3-hydroquinazolin-4-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₅H₁₂N₂OS

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 268.33 g/mol

Ref: 3D-FP168992