CymitQuimica logo

CAS 63440-60-8

:

(2-methylphenyl)(oxo)acetaldehyde

Description:
(2-Methylphenyl)(oxo)acetaldehyde, also known by its CAS number 63440-60-8, is an organic compound characterized by the presence of both an aldehyde functional group and a ketone moiety. This compound features a 2-methylphenyl group, which contributes to its aromatic properties, and an oxoacetaldehyde structure, indicating the presence of a carbonyl group adjacent to an aldehyde. The molecular structure suggests that it may exhibit reactivity typical of aldehydes, such as undergoing nucleophilic addition reactions. Additionally, the presence of the aromatic ring can influence its physical properties, such as solubility and boiling point, making it more hydrophobic compared to aliphatic aldehydes. The compound may also participate in various chemical reactions, including condensation and oxidation, and could be of interest in synthetic organic chemistry for the development of more complex molecules. Its specific applications and behavior in reactions would depend on the surrounding conditions and the presence of other reactants.
Formula:C9H8O2
InChI:InChI=1/C9H8O2/c1-7-4-2-3-5-8(7)9(11)6-10/h2-6H,1H3
InChI key:ILRFLXHICGHRIN-UHFFFAOYSA-N
SMILES:Cc1ccccc1C(=O)C=O
Found 4 products.