CAS 63445-53-4: 6,7-dimethoxy-3-methyl-1-benzofuran-2-carboxylic acid

Description: 6,7-Dimethoxy-3-methyl-1-benzofuran-2-carboxylic acid is an organic compound characterized by its unique benzofuran structure, which consists of a fused benzene and furan ring. The presence of two methoxy groups at the 6 and 7 positions contributes to its chemical reactivity and solubility properties, while the methyl group at the 3 position adds to its molecular complexity. The carboxylic acid functional group at the 2 position imparts acidic characteristics, allowing for potential interactions in various chemical environments. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry. Additionally, the compound's solubility and stability can be influenced by the presence of the methoxy and carboxylic acid groups, which can affect its behavior in different solvents and under varying pH conditions. Overall, 6,7-dimethoxy-3-methyl-1-benzofuran-2-carboxylic acid is a versatile compound with potential implications in various fields of chemistry and biology.

Formula: C₁₂H₁₂O₅

InChI: InChI=1/C12H12O5/c1-6-7-4-5-8(15-2)11(16-3)10(7)17-9(6)12(13)14/h4-5H,1-3H3,(H,13,14)

6,7-dimethoxy-3-methyl-1-benzofuran-2-carboxylic acid

CAS: 63445-53-4

• Purity: 95.0%
• Molecular weight: 236.22300720214844

6,7-Dimethoxy-3-methyl-1-benzofuran-2-carboxylic acid

CAS: 63445-53-4

Versatile small molecule scaffold

• Formula: C₁₂H₁₂O₅
• Purity: Min. 95%
• Molecular weight: 236.22 g/mol