CAS 634469-41-3

4-Chloro-2-piperazin-1-yl-pyrimidine hydrochloride

Description:

4-Chloro-2-piperazin-1-yl-pyrimidine hydrochloride is a chemical compound characterized by its heterocyclic structure, which includes a pyrimidine ring substituted with a chloro group and a piperazine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it suitable for pharmaceutical applications. The presence of the piperazine group often contributes to its biological activity, potentially influencing its interaction with various receptors or enzymes. As a hydrochloride salt, it is generally more stable and easier to handle than its free base form. The compound is of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its potential pharmacological properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices. Overall, 4-Chloro-2-piperazin-1-yl-pyrimidine hydrochloride represents a versatile building block in drug discovery and development.

Formula: C₈H₁₂Cl₂N₄

InChI: InChI=1/C8H11ClN4.ClH/c9-7-1-2-11-8(12-7)13-5-3-10-4-6-13;/h1-2,10H,3-6H2;1H

SMILES: c1cnc(nc1Cl)N1CCNCC1.Cl

4-Chloro-2-piperazin-1-yl-pyrimidine HCl

CAS: 634469-41-3

Formula: C₈H₁₂Cl₂N₄

Purity: 95%

Molecular weight: 235.1137

Ref: IN-DA003L2A

4-Chloro-2-(piperazin-1-yl)pyrimidine hydrochloride

CAS: 634469-41-3

Formula: C₈H₁₂Cl₂N₄

Purity: 95%

Molecular weight: 235.11

Ref: 10-F235261