CAS 63449-37-6

ethyl 4-[(2-ethoxy-2-oxoethyl)thio]butanoate

Description:

Ethyl 4-[(2-ethoxy-2-oxoethyl)thio]butanoate, identified by its CAS number 63449-37-6, is an organic compound characterized by its ester functional group, which contributes to its reactivity and solubility properties. This substance features a butanoate backbone, indicating a four-carbon chain with an ester group, and a thioether moiety that introduces sulfur into its structure, enhancing its chemical diversity. The presence of the ethoxy and keto groups suggests potential for hydrogen bonding and reactivity in various chemical environments. Ethyl 4-[(2-ethoxy-2-oxoethyl)thio]butanoate is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its unique structure may impart specific biological activities, making it of interest in fields such as pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₀H₁₈O₄S

InChI: InChI=1/C10H18O4S/c1-3-13-9(11)6-5-7-15-8-10(12)14-4-2/h3-8H2,1-2H3

SMILES: CCOC(=O)CCCSCC(=O)OCC

Synonyms:

• Ethyl 4-[(2-Ethoxy-2-Oxoethyl)Sulfanyl]Butanoate

Ethyl 4-[(2-ethoxy-2-oxoethyl)thio]butanoate

CAS: 63449-37-6

Ethyl 4-[(2-ethoxy-2-oxoethyl)thio]butanoate

Purity: ≥95%

Molecular weight: 234.31g/mol

Ref: 54-OR25342