CymitQuimica logo

CAS 63449-78-5

:

4-(4-hydroxy-3-methoxybenzylidene)-2-methyl-1,3-oxazol-5(4H)-one

Description:
4-(4-hydroxy-3-methoxybenzylidene)-2-methyl-1,3-oxazol-5(4H)-one, identified by its CAS number 63449-78-5, is a chemical compound that belongs to the class of oxazolone derivatives. This compound features a benzylidene moiety, which is characterized by the presence of a methoxy and a hydroxy group on the aromatic ring, contributing to its potential biological activity. The oxazolone structure imparts unique reactivity, making it of interest in various chemical syntheses and potential applications in pharmaceuticals. The presence of functional groups such as the hydroxy and methoxy groups can enhance solubility and influence the compound's interaction with biological targets. Additionally, compounds of this nature may exhibit properties such as antioxidant or anti-inflammatory activities, although specific biological activities would require empirical investigation. Overall, the structural features of this compound suggest it may have diverse applications in medicinal chemistry and materials science, warranting further research into its properties and potential uses.
Formula:C12H11NO4
InChI:InChI=1/C12H11NO4/c1-7-13-9(12(15)17-7)5-8-3-4-10(14)11(6-8)16-2/h3-6,14H,1-2H3
SMILES:CC1=NC(=Cc2ccc(c(c2)OC)O)C(=O)O1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.