CAS 634593-20-7

2-[(2,2-dimethylpropanoyl)amino]-5-methylthiophene-3-carboxylic acid

Description:

2-[(2,2-Dimethylpropanoyl)amino]-5-methylthiophene-3-carboxylic acid, with the CAS number 634593-20-7, is a chemical compound characterized by its unique structure that includes a thiophene ring, an amino group, and a carboxylic acid functional group. The presence of the thiophene ring imparts aromatic properties, while the carboxylic acid group contributes to its acidity and potential for forming salts or esters. The compound also features a dimethylpropanoyl substituent, which enhances its steric bulk and may influence its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility can vary depending on the solvent, and it may participate in various chemical reactions typical of amino acids and carboxylic acids, such as peptide bond formation or esterification. Overall, the compound's structural features suggest potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and spectral data would require empirical determination.

Formula: C₁₁H₁₅NO₃S

InChI: InChI=1/C11H15NO3S/c1-6-5-7(9(13)14)8(16-6)12-10(15)11(2,3)4/h5H,1-4H3,(H,12,15)(H,13,14)

SMILES: Cc1cc(c(N=C(C(C)(C)C)O)s1)C(=O)O

2-[(2,2-dimethylpropanoyl)amino]-5-methyl-3-thiophenecarboxylic acid

CAS: 634593-20-7

Formula: C₁₁H₁₅NO₃S

Purity: 95.0%

Molecular weight: 241.31

Ref: 10-F315511