CAS 63467-53-8
:N-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine hydrochloride (1:1)
Description:
N-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine hydrochloride, with the CAS number 63467-53-8, is a chemical compound that belongs to the class of nitroxides, which are stable free radicals. This substance is characterized by its unique structure, featuring a piperidine ring substituted with hydroxyl and imine functional groups, contributing to its stability and reactivity. It typically appears as a crystalline solid and is soluble in polar solvents, such as water and alcohols. The presence of the hydroxyl group enhances its ability to participate in various chemical reactions, making it useful in organic synthesis and as a radical scavenger. Additionally, its hydrochloride form indicates that it is a salt, which can influence its solubility and stability in different environments. N-hydroxy-2,2,6,6-tetramethylpiperidin-4-imine hydrochloride is often utilized in polymer chemistry, particularly in the stabilization of polymers against oxidative degradation. Safety precautions should be observed when handling this compound, as with many chemicals, due to potential health hazards.
Formula:C9H18N2O·ClH
InChI:InChI=1S/C9H18N2O.ClH/c1-8(2)5-7(10-12)6-9(3,4)11-8;/h11-12H,5-6H2,1-4H3;1H
InChI key:InChIKey=PMDFGKBTEGXYED-UHFFFAOYSA-N
SMILES:CC1(C)NC(C)(C)CC(=NO)C1.Cl
Synonyms:- 2,2,6,6-Tetramethylpiperidin-4-one oxime hydrochloride
- 4-Piperidinone, 2,2,6,6-Tetramethyl-, Oxime, Hydrochloride (1:1)
- 4-Piperidinone, 2,2,6,6-tetramethyl-, oxime, monohydrochloride
- Tempoxime hydrochloride
- N-Hydroxy-2,2,6,6-tetramethylpiperidin-4-imine hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tempoxime Hydrochloride
CAS:Controlled ProductFormula:C9H18N2O•HClColor and Shape:NeatMolecular weight:170.25 +(36.46)
