CAS 63468-95-1
:2,2′-Methylenebis[5-(dimethylamino)phenol]
Description:
2,2′-Methylenebis[5-(dimethylamino)phenol], with CAS number 63468-95-1, is an organic compound characterized by its structure, which features two 5-(dimethylamino)phenol units linked by a methylene bridge. This compound is typically a solid at room temperature and exhibits a high melting point. It is known for its applications in the field of polymer chemistry, particularly as a curing agent or hardener in epoxy resins. The presence of dimethylamino groups contributes to its reactivity, making it useful in various chemical reactions, including those involving cross-linking. Additionally, it may exhibit properties such as good solubility in organic solvents and potential color stability, which are advantageous in industrial applications. However, handling this compound requires caution due to its potential toxicity and the need for appropriate safety measures to mitigate exposure risks. Overall, 2,2′-Methylenebis[5-(dimethylamino)phenol] is a significant compound in materials science, particularly in the development of advanced polymeric materials.
Formula:C17H22N2O2
InChI:InChI=1S/C17H22N2O2/c1-18(2)14-7-5-12(16(20)10-14)9-13-6-8-15(19(3)4)11-17(13)21/h5-8,10-11,20-21H,9H2,1-4H3
InChI key:InChIKey=CFEFGULMFHEIBY-UHFFFAOYSA-N
SMILES:C(C1=C(O)C=C(N(C)C)C=C1)C2=C(O)C=C(N(C)C)C=C2
Synonyms:- Phenol, 2,2′-methylenebis[5-(dimethylamino)-
- 2,2′-Methylenebis[5-(dimethylamino)phenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
