CAS 63473-60-9

(R)-1-methyl hydrogen 3-methylglutarate

Description:

(R)-1-methyl hydrogen 3-methylglutarate is an organic compound characterized by its chiral nature, which is indicated by the (R) configuration at the stereocenter. This compound features a methyl group attached to the first carbon and a hydrogen atom on the third carbon of the glutarate backbone, contributing to its unique structural properties. It is a derivative of glutaric acid and is part of a broader class of carboxylic acid esters. The presence of multiple methyl groups enhances its hydrophobic characteristics, influencing its solubility and reactivity in various chemical environments. This compound may be utilized in synthetic organic chemistry, particularly in the synthesis of more complex molecules or as an intermediate in various chemical reactions. Its specific stereochemistry can also play a crucial role in determining its biological activity and interactions with other molecules. As with many organic compounds, safety and handling precautions should be observed, as it may exhibit toxicity or irritant properties depending on concentration and exposure.

Formula: C₇H₁₂O₄

InChI: InChI=1/C7H12O4/c1-5(3-6(8)9)4-7(10)11-2/h5H,3-4H2,1-2H3,(H,8,9)/t5-/m1/s1

SMILES: C[C@H](CC(=O)O)CC(=O)OC

Synonyms:

• Methyl (R)-(+)-3-methylglutarate
• (3R)-5-methoxy-3-methyl-5-oxopentanoic acid

(R)-3-Methylpentanedioic Acid Monomethyl Ester

Controlled Product

CAS: 63473-60-9

Formula: C₇H₁₂O₄

Color and Shape: Neat

Molecular weight: 160.17

Ref: TR-P190820