CAS 63476-93-7

4-Formylbenzamidine hydrochloride

Description:

4-Formylbenzamidine hydrochloride is a chemical compound characterized by its structural features, which include a benzene ring substituted with both an aldehyde group and an amidine functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the formyl group contributes to its reactivity, particularly in condensation reactions, while the amidine moiety can participate in various chemical transformations, including nucleophilic additions. It is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. The hydrochloride salt form enhances its stability and solubility, facilitating its use in biological studies. As with many chemical substances, safety precautions should be observed when handling 4-Formylbenzamidine hydrochloride, as it may pose health risks if ingested or inhaled. Proper storage conditions are also essential to maintain its integrity and prevent degradation.

Formula: C₈H₉ClN₂O

InChI: InChI=1/C8H8N2O.ClH/c9-8(10)7-3-1-6(5-11)2-4-7;/h1-5H,(H3,9,10);1H

SMILES: c1cc(ccc1C=O)C(=N)N.Cl

Synonyms:

• 4-Formylbenzenecarboximidamide Hydrochloride

4-Formyl benzamidine, HCl

CAS: 63476-93-7

Formula: C₈H₉ClN₂O

Molecular weight: 184.6229

Ref: IN-DA00EAOQ

4-Formyl benzamidine hydrochloride

CAS: 63476-93-7

Formula: C₈H₉ClN₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 184.62

Ref: 10-F011745