CymitQuimica logo

CAS 63480-11-5

:

7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione

Description:
7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione, also known by its CAS number 63480-11-5, is a heterocyclic organic compound characterized by a benzoxazine structure. This compound features a fused benzene and oxazine ring, with a methyl group at the 7-position and two carbonyl groups at the 2 and 4 positions, contributing to its dione classification. It is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of the carbonyl groups imparts reactivity, making it a potential candidate for various chemical reactions, including cycloadditions and polymerization processes. Its unique structure allows for applications in materials science, particularly in the development of thermosetting resins and coatings. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, 7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione is a compound of interest in both synthetic chemistry and material science due to its distinctive properties and reactivity.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c1-5-2-3-6-7(4-5)10-9(12)13-8(6)11/h2-4H,1H3,(H,10,12)
InChI key:InChIKey=FTOHSJGKIFDLQU-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)O1)=CC(C)=CC2
Synonyms:
  • 2H-3,1-benzoxazine-2,4(1H)-dione, 7-methyl-
  • 4-Methylisatoic anhydride
  • 7-methyl-1-H-benzo[d][1,3]oxazine-2,4-dione
  • Isatoic anhydride, 4-methyl-
  • 7-Methyl-2H-3,1-benzoxazine-2,4(1H)-dione
Found 5 products.