CAS 63483-95-4: 5-(2-amino-1-hydroxybutyl)-8-hydroxyquinolin-2(1H)-one

Description:5-(2-amino-1-hydroxybutyl)-8-hydroxyquinolin-2(1H)-one, with the CAS number 63483-95-4, is a chemical compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is characterized by a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of an 8-hydroxy group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. The amino and hydroxybutyl substituents enhance its solubility and reactivity, making it of interest in various biochemical applications. This compound may exhibit biological activity, including antimicrobial or antitumor properties, due to its structural features. Additionally, its ability to interact with biological systems suggests potential uses in pharmaceuticals or as a research tool in biochemistry. However, specific applications and biological effects would depend on further empirical studies and evaluations. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula:C₁₃H₁₆N₂O₃

InChI:InChI=1/C13H16N2O3/c1-2-9(14)13(18)8-3-5-10(16)12-7(8)4-6-11(17)15-12/h3-6,9,13,16,18H,2,14H2,1H3,(H,15,17)