CAS 63485-75-6: 7-methoxy-8-nitroisoquinoline

Description: 7-Methoxy-8-nitroisoquinoline is a chemical compound characterized by its isoquinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methoxy group (-OCH3) at the 7-position and a nitro group (-NO2) at the 8-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid and is soluble in organic solvents, reflecting its aromatic nature. The nitro group can participate in electrophilic substitution reactions, while the methoxy group can influence the compound's reactivity and polarity. 7-Methoxy-8-nitroisoquinoline may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its molecular structure allows for potential interactions with biological targets, which could lead to applications in drug development. However, specific safety and handling guidelines should be followed due to the presence of the nitro group, which can be associated with toxicity. Overall, this compound represents a valuable scaffold for further research in various chemical and biological contexts.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1/C10H8N2O3/c1-15-9-3-2-7-4-5-11-6-8(7)10(9)12(13)14/h2-6H,1H3

Synonyms:

• Isoquinoline, 7-Methoxy-8-Nitro-

7-methoxy-8-nitroisoquinoline

CAS: 63485-75-6

• Molecular weight: 204.18499755859375

7-Methoxy-8-nitroisoquinoline

CAS: 63485-75-6

Please enquire for more information about 7-Methoxy-8-nitroisoquinoline including the price, delivery time and more detailed …

• Formula: C₁₀H₈N₂O₃
• Purity: Min. 95%
• Molecular weight: 204.18 g/mol