CAS 63489-58-7

2,6-Difluoropyridin-4-amine

Description:

2,6-Difluoropyridin-4-amine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two fluorine atoms at the 2 and 6 positions and an amino group (-NH2) at the 4 position contributes to its unique chemical properties. This compound is typically a colorless to light yellow liquid or solid, depending on its form and purity. It is soluble in polar solvents, such as water and alcohols, due to the presence of the amino group, which can engage in hydrogen bonding. The fluorine substituents enhance the compound's reactivity and influence its electronic properties, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.

Formula: C₅H₄F₂N₂

InChI: InChI=1/C5H4F2N2/c6-4-1-3(8)2-5(7)9-4/h1-2H,(H2,8,9)

SMILES: c1c(cc(F)nc1F)N

Synonyms:

• 4-Pyridinamine, 2,6-Difluoro-
• 2,6-difluoro-4-Pyridinamine

4-Amino-2,6-difluoropyridine

CAS: 63489-58-7

Formula: C₅H₄F₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 130.0955

Ref: IN-DA00E9TM

4-Amino-2,6-difluoropyridine

CAS: 63489-58-7

4-Amino-2,6-difluoropyridine

Formula: C₅H₄F₂N₂

Purity: 97%

Color and Shape: pale yellow solid

Molecular weight: 130.10g/mol

Ref: 54-PC9706

4-Amino-2,6-difluoropyridine

CAS: 63489-58-7

Formula: C₅H₄F₂N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 130.098

Ref: 10-F049767