CAS 634911-81-2: N-[(benzyloxy)carbonyl]-L-valyl-N-[3-fluoro-1-(2-methoxy-2-oxoethyl)-2-oxopropyl]-L-alaninamide
Description:N-[(benzyloxy)carbonyl]-L-valyl-N-[3-fluoro-1-(2-methoxy-2-oxoethyl)-2-oxopropyl]-L-alaninamide, with CAS number 634911-81-2, is a synthetic compound that belongs to the class of peptide derivatives. This substance features a complex structure characterized by the presence of amino acid residues, specifically L-valine and L-alanine, which are linked through peptide bonds. The compound also contains a benzyloxycarbonyl (Z) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. Additionally, it incorporates a fluorinated moiety, which can enhance biological activity or alter pharmacokinetic properties. The methoxy and keto groups contribute to its overall reactivity and potential interactions in biological systems. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, due to their ability to mimic natural peptides and proteins. As with many synthetic compounds, its stability, solubility, and biological activity would be of interest in research and application contexts.
Formula:C22H30FN3O7
InChI:InChI=1/C22H30FN3O7/c1-13(2)19(26-22(31)33-12-15-8-6-5-7-9-15)21(30)24-14(3)20(29)25-16(17(27)11-23)10-18(28)32-4/h5-9,13-14,16,19H,10-12H2,1-4H3,(H,24,30)(H,25,29)(H,26,31)/t14-,16?,19-/m0/s1