CAS 634922-11-5

(8aS)-Octahydropyrrolo[1,2-a]pyrazine dihydrochloride

Description:

(8aS)-Octahydropyrrolo[1,2-a]pyrazine dihydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a pyrazine ring fused to a saturated pyrrolidine-like system. This compound is typically a white to off-white solid, and its dihydrochloride form indicates the presence of two hydrochloride ions associated with the base structure, enhancing its solubility in polar solvents like water. The stereochemistry, denoted by the (8aS) designation, suggests specific spatial arrangements of atoms that can influence its biological activity and interactions. As a nitrogen-containing heterocycle, it may exhibit properties relevant to medicinal chemistry, potentially serving as a scaffold for drug development. The compound's CAS number, 634922-11-5, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, (8aS)-Octahydropyrrolo[1,2-a]pyrazine dihydrochloride represents a compound of interest in various fields, including pharmacology and organic synthesis.

Formula: C₇H₁₆Cl₂N₂

InChI: InChI=1S/C7H14N2.2ClH/c1-2-7-6-8-3-5-9(7)4-1;;/h7-8H,1-6H2;2*1H/t7-;;/m0../s1

SMILES: C1C[C@H]2CNCCN2C1.Cl.Cl

Synonyms:

• (S)-octahydropyrrolo[1,2-a]pyrazine-2HCl

(S)-octahydropyrrolo[1,2-a]pyrazine-2HCl

CAS: 634922-11-5

Formula: C₇H₁₆Cl₂N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 199.1213

Ref: IN-DA00EGS4

(S)-Octahydropyrrolo[1,2-a]pyrazine dihydrochloride

CAS: 634922-11-5

(S)-Octahydropyrrolo[1,2-a]pyrazine dihydrochloride

Purity: 97%

Molecular weight: 199.12g/mol

Ref: 54-OR75776

(S)-Octahydropyrrolo[1,2-a]pyrazinedihydrochloride

CAS: 634922-11-5

Formula: C₇H₁₆Cl₂N₂

Purity: 97%

Molecular weight: 199.12

Ref: 10-F210363