CAS 63504-15-4
:(1Z)-N'-carbamoyl-2-(2,6-dichlorophenyl)ethanimidamide hydrochloride (1:1)
Description:
(1Z)-N'-carbamoyl-2-(2,6-dichlorophenyl)ethanimidamide hydrochloride is a chemical compound characterized by its specific structural features, including a carbamoyl group and a dichlorophenyl moiety. This compound is typically classified as an organic amide, which suggests it may exhibit properties such as solubility in polar solvents and potential biological activity. The presence of the hydrochloride indicates that it is a salt form, which can enhance its stability and solubility in aqueous environments. The dichlorophenyl group may contribute to its lipophilicity, influencing its interaction with biological membranes. Additionally, the compound's imidamide structure suggests potential reactivity and interaction with various biological targets, making it of interest in pharmaceutical research. Its CAS number, 63504-15-4, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, this compound's unique characteristics position it as a subject of interest in medicinal chemistry and related fields.
Formula:C9H10Cl3N3O
InChI:InChI=1/C9H9Cl2N3O.ClH/c10-6-2-1-3-7(11)5(6)4-8(12)14-9(13)15;/h1-3H,4H2,(H4,12,13,14,15);1H
Synonyms:- LON 954
- N-(2,5-Dichlorophenyl)-N'-phenyl-N'-[1-(phenylimino)ethyl]urea
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lon 954
CAS:<p>Lon 954, also known as Harmine, is a fluorescent harmala alkaloid belonging to the beta-carboline family of compounds.</p>Formula:C9H10Cl3N3OColor and Shape:SolidMolecular weight:282.55
