CAS 63521-95-9

2-Thiophenecarbonyl chloride, tetrahydro-

Description:

2-Thiophenecarbonyl chloride, tetrahydro- is an organic compound characterized by the presence of a thiophene ring and a carbonyl chloride functional group. This compound typically exhibits a molecular structure that includes a five-membered aromatic ring containing sulfur, which contributes to its unique chemical properties. The carbonyl chloride group indicates that it is a reactive acyl chloride, making it useful in various synthetic applications, particularly in the formation of esters and amides. The tetrahydro designation suggests that the compound may have additional saturated carbon atoms, which can influence its reactivity and physical properties. Generally, compounds like 2-thiophenecarbonyl chloride are sensitive to moisture and can hydrolyze to form corresponding acids. They are often handled with care due to their potential to release hydrochloric acid upon reaction. In terms of applications, such compounds are valuable in organic synthesis, particularly in the pharmaceutical and agrochemical industries, where they can serve as intermediates in the production of more complex molecules.

Formula: C₅H₇ClOS

InChI: InChI=1S/C5H7ClOS/c6-5(7)4-2-1-3-8-4/h4H,1-3H2

InChI key: GMOYADYGFDLPHE-UHFFFAOYSA-N

SMILES: C1CC(SC1)C(=O)Cl