CAS 63545-55-1
:3-(4-Mercaptophenyl)propanoic acid
Description:
3-(4-Mercaptophenyl)propanoic acid, with the CAS number 63545-55-1, is an organic compound characterized by the presence of both a carboxylic acid group and a thiol group. This compound features a propanoic acid backbone, where a phenyl ring substituted with a mercapto (-SH) group is attached to the third carbon of the propanoic chain. The presence of the thiol group imparts distinct chemical properties, such as the ability to form disulfide bonds and participate in redox reactions. The carboxylic acid group contributes to its acidity and potential for hydrogen bonding, influencing its solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, its functional groups allow for various chemical modifications, which can be utilized in synthetic applications. Overall, 3-(4-Mercaptophenyl)propanoic acid is a versatile compound with potential applications in materials science, biochemistry, and medicinal chemistry.
Formula:C9H10O2S
InChI:InChI=1S/C9H10O2S/c10-9(11)6-3-7-1-4-8(12)5-2-7/h1-2,4-5,12H,3,6H2,(H,10,11)
InChI key:InChIKey=YQWPHBFLHAJVCG-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C1=CC=C(S)C=C1
Synonyms:- 3-(4-Mercaptophenyl)propanoic acid
- 3-(4-Mercaptophenyl)propionic acid
- 3-(4-Sulfanylphenyl)Propanoic Acid
- 4-Mercaptobenzenepropanoic acid
- 4-Mercaptodihydrocinnamic acid
- 4-Mercaptohydrocinnamic acid
- Benzenepropanoic acid, 4-mercapto-
- Hydrocinnamic acid, p-mercapto-
- p-Mercaptohydrocinnamic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Mercaptohydrocinnamic Acid
CAS:Formula:C9H10O2SPurity:>95.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:182.244-Mercaptohydrocinnamic acid
CAS:Formula:C9H10O2SPurity:95%Color and Shape:SolidMolecular weight:182.23954-Mercaptohydrocinnamic acid
CAS:Formula:C9H10O2SPurity:95%(HPLC)(T)Color and Shape:SolidMolecular weight:182.244-Mercaptophenylpropionic acid
CAS:4-Mercaptophenylpropionic acid (MPPA) is a synthetic molecule with two phenyl groups that can be used in a variety of chemical reactions. MPPA reacts with hydroxide solution to form conjugates, which are 3-mercaptopropionic acid (3MPA) and 4-mercaptobenzoic acid. Reaction vessel studies have shown that MPPA forms gels when mixed with amide crosslinkers. These gels are stabilized by surface-enhanced raman spectroscopy, which causes the molecules to form hydrogen bonds with the surrounding water molecules. The molecular weight of heparin can be determined by gel electrophoresis using MPPA as the gelation agent.Formula:C9H10O2SPurity:Min. 98 Area-%Color and Shape:Yellow PowderMolecular weight:182.24 g/mol





