
CAS 63549-33-7
:3-Chloro-1-(5-chloro-2-methylphenyl)-1-propanone
Description:
3-Chloro-1-(5-chloro-2-methylphenyl)-1-propanone, with the CAS number 63549-33-7, is an organic compound characterized by its ketone functional group and the presence of chlorine and methyl substituents on its aromatic ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the carbonyl group, which can participate in various chemical reactions, including nucleophilic additions. The chlorine atoms in the structure can influence its chemical behavior, making it a potential candidate for further synthetic applications in organic chemistry. Additionally, this compound may exhibit biological activity, which could be of interest in pharmaceutical research. However, safety precautions should be taken when handling it, as halogenated compounds can pose health risks. Proper storage and disposal methods are essential to mitigate any environmental impact.
Formula:C10H10Cl2O
InChI:InChI=1S/C10H10Cl2O/c1-7-2-3-8(12)6-9(7)10(13)4-5-11/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=VBICFYLYNPVUKS-UHFFFAOYSA-N
SMILES:C(CCCl)(=O)C1=C(C)C=CC(Cl)=C1
Synonyms:- 1-Propanone, 3-chloro-1-(5-chloro-2-methylphenyl)-
- 3-Chloro-1-(5-chloro-2-methylphenyl)-1-propanone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery