CAS 63551-14-4
:3-(1-Methyl-1-oxido-2-pyrrolidinyl)pyridine
Description:
3-(1-Methyl-1-oxido-2-pyrrolidinyl)pyridine, identified by its CAS number 63551-14-4, is a chemical compound that features a pyridine ring substituted with a pyrrolidine moiety. This compound is characterized by its nitrogen-containing heterocyclic structures, which contribute to its potential biological activity. The presence of the oxido group indicates that it may have unique reactivity and stability properties. Typically, compounds like this can exhibit various pharmacological effects, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may engage in hydrogen bonding and other interactions due to the functional groups present, influencing its solubility and reactivity. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound's unique features position it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-12(13)7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3
InChI key:InChIKey=RWFBQHICRCUQJJ-UHFFFAOYSA-N
SMILES:CN1(=O)C(C=2C=CC=NC2)CCC1
Synonyms:- 1-Methyl-2-(pyridin-3-yl)pyrrolidin-1-ium-1-olate
- 3-(1-Methyl-1-oxido-2-pyrrolidinyl)pyridine
- 3-(1-Methyl-1-oxidopyrrolidin-1-ium-2-yl)pyridine
- Pyridine, 3-(1-methyl-1-oxido-2-pyrrolidinyl)-
- Pyridine, 3-(1-methyl-2-pyrrolidinyl)-, N-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
rac-Nicotine EP Impurity E (rac-Nicotine-1'-Oxide) (Mixture of Diastereomers)
CAS:Formula:C10H14N2OColor and Shape:White To Off-White SolidMolecular weight:178.24

