CAS 635698-34-9

6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-e]pyrimidine-2,4-dione

Description:

6-benzyl-5,7-dihydro-1H-pyrrolo[3,4-e]pyrimidine-2,4-dione is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. This compound features a benzyl group, contributing to its hydrophobic characteristics and potential for interactions in biological systems. The presence of the diketone functional groups (2,4-dione) suggests that it may exhibit reactivity typical of carbonyl compounds, such as nucleophilic addition or condensation reactions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with similar heterocyclic compounds. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the benzyl group and the overall electronic environment of the bicyclic system. As with many organic compounds, its properties can be further explored through techniques such as NMR, IR spectroscopy, and mass spectrometry to elucidate its behavior in various chemical contexts.

Formula: C₁₃H₁₃N₃O₂

InChI: InChI=1/C13H13N3O2/c17-12-10-7-16(6-9-4-2-1-3-5-9)8-11(10)14-13(18)15-12/h1-5H,6-8H2,(H2,14,15,17,18)

SMILES: c1ccc(cc1)CN1Cc2c(C1)nc(nc2O)O

Synonyms:

• 6-Benzyl-6,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,5H)-dione

6-Benzyl-6,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,5H)-dione

CAS: 635698-34-9

Formula: C₁₃H₁₃N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 243.2612

Ref: IN-DA00E9P4

6-Benzyl-1,5,6,7-tetrahydro-2H-pyrrolo[3,4-d]pyrimidine-2,4(3H)-dione

CAS: 635698-34-9

6-Benzyl-1,5,6,7-tetrahydro-2H-pyrrolo[3,4-d]pyrimidine-2,4(3H)-dione

Purity: 98%

Molecular weight: 243.26g/mol

Ref: 54-OR85415

6-Benzyl-6,7-dihydro-1H-pyrrolo[3,4-d]pyrimidine-2,4(3H,5H)-dione

CAS: 635698-34-9

Formula: C₁₃H₁₃N₃O₂

Purity: 98%

Molecular weight: 243.266

Ref: 10-F092384