CAS 6357-75-1
:8-Amino-5-[(4-hydroxyphenyl)amino]-2-naphthalenesulfonic acid
Description:
8-Amino-5-[(4-hydroxyphenyl)amino]-2-naphthalenesulfonic acid, commonly referred to as a naphthalenesulfonic acid derivative, is an organic compound characterized by its sulfonic acid functional group, amino groups, and a hydroxyl group attached to a naphthalene ring system. This compound typically exhibits good solubility in water due to the presence of the sulfonic acid group, which enhances its ionic character. It is often used in dye chemistry, particularly in the synthesis of azo dyes, due to its ability to form stable complexes with metal ions and its reactivity with other organic compounds. The presence of multiple functional groups allows for various chemical modifications, making it versatile in applications such as textile dyeing and biological staining. Additionally, its structural features may contribute to specific interactions in biological systems, potentially influencing its behavior in pharmaceutical or biochemical contexts. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H14N2O4S
InChI:InChI=1S/C16H14N2O4S/c17-15-7-8-16(18-10-1-3-11(19)4-2-10)13-6-5-12(9-14(13)15)23(20,21)22/h1-9,18-19H,17H2,(H,20,21,22)
InChI key:InChIKey=CAUOCGDGBOJRSS-UHFFFAOYSA-N
SMILES:N(C=1C2=C(C=C(S(=O)(=O)O)C=C2)C(N)=CC1)C3=CC=C(O)C=C3
Synonyms:- 2-Naphthalenesulfonic acid, 8-amino-5-(p-hydroxyanilino)-
- 2-Naphthalenesulfonic acid, 8-amino-5-[(4-hydroxyphenyl)amino]-
- 8-Amino-5-[(4-hydroxyphenyl)amino]-2-naphthalenesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Amino-5-[(4-hydroxyphenyl)amino]-2-naphthalenesulfonic Acid
CAS:Controlled ProductApplications A diamino substituted nathalenesulfonic acid derivative.
Formula:C16H14N2O4SColor and Shape:NeatMolecular weight:330.358
