CAS 635712-44-6

5-bromo-7-chloro-1H-indazole

Description:

5-Bromo-7-chloro-1H-indazole is a heterocyclic organic compound characterized by its indazole core, which consists of a fused five-membered and six-membered ring containing nitrogen atoms. The presence of bromine and chlorine substituents at the 5 and 7 positions, respectively, contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic nature. It is often utilized in medicinal chemistry and research for its potential biological activities, including antimicrobial and anticancer properties. The presence of halogen atoms can enhance its reactivity and influence its interaction with biological targets. Additionally, 5-bromo-7-chloro-1H-indazole can serve as a valuable intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks. Overall, its structural features and substituents make it a compound of interest in various fields of chemical research.

Formula: C₇H₄BrClN₂

InChI: InChI=1/C7H4BrClN2/c8-5-1-4-3-10-11-7(4)6(9)2-5/h1-3H,(H,10,11)

SMILES: c1c2cn[nH]c2c(cc1Br)Cl

Synonyms:

• 1H-Indazole, 5-bromo-7-chloro-

5-Bromo-7-chloro-1H-indazole, 96%

CAS: 635712-44-6

<p></p>

Formula: C₇H₄BrClN₂

Purity: 96%

Color and Shape: Powder, Brown

Molecular weight: 231.48

Ref: 02-H36816

5-bromo-7-chloro-1H-indazole

CAS: 635712-44-6

Formula: C₇H₄BrClN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.4771

Ref: IN-DA00E9PE

5-Bromo-7-chloro-1H-indazole

CAS: 635712-44-6

5-Bromo-7-chloro-1H-indazole

Purity: 98%

Molecular weight: 231.48g/mol

Ref: 54-OR92491

5-BROMO-7-CHLORO-1H-INDAZOLE

CAS: 635712-44-6

Purity: 98%

Molecular weight: 231.4799957

Ref: 10-F794516

5-Bromo-7-chloro-1H-indazole

CAS: 635712-44-6

Formula: C₇H₄BrClN₂

Purity: 98%

Molecular weight: 231.48

Ref: 10-F217553