CAS 635713-68-7

spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one

Description:

Spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one is a heterocyclic compound characterized by its unique spirocyclic structure, which consists of a quinazoline moiety fused with a piperidine ring. This compound typically exhibits a bicyclic framework, where the spiro center connects the two rings, contributing to its distinct three-dimensional shape. The presence of the carbonyl group (ketone) at the 2-position of the piperidine ring enhances its reactivity and potential biological activity. Compounds of this class may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure often influences solubility, stability, and interaction with biological targets. Additionally, the compound's synthesis may involve multi-step organic reactions, and its characterization can be performed using techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography. Overall, spiro[1,3-dihydroquinazoline-4,4'-piperidine]-2-one represents a fascinating area of study due to its structural complexity and potential applications in drug development.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1/C12H15N3O/c16-11-14-10-4-2-1-3-9(10)12(15-11)5-7-13-8-6-12/h1-4,13H,5-8H2,(H2,14,15,16)

SMILES: c1ccc2c(c1)C1(CCNCC1)NC(=N2)O

Synonyms:

• 1'H-Spiro[piperidine-4,4'-quinazolin]-2'(3'H)-one
• spiro[piperidine-4,4'(1'H)-quinazolin]-2'(3'H)-one2'',3''-Dihydro-2''-Oxospiro-[Piperidine-4,4''(1H'')-Quinazoline

1'H-Spiro[piperidine-4,4'-quinazolin]-2'(3'H)-one

CAS: 635713-68-7

1'H-Spiro[piperidine-4,4'-quinazolin]-2'(3'H)-one

Purity: 96%

Molecular weight: 217.27g/mol

Ref: 54-OR1065716

1'H-Spiro[piperidine-4,4'-quinazolin]-2'(3'H)-one

CAS: 635713-68-7

Purity: 95.0%

Molecular weight: 217.27200317382812

Ref: 10-F219328