CAS 63572-73-6

5-nitro-1H-pyrazolo[3,4-b]pyridine

Description:

5-Nitro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo and pyridine rings, which contribute to its unique chemical properties. This compound features a nitro group (-NO2) at the 5-position of the pyrazolo ring, enhancing its reactivity and potential applications in various chemical reactions. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents due to the presence of the nitro group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and material science, often investigated for its biological activities, including potential anti-inflammatory and antimicrobial properties. Its structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many nitro compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 5-nitro-1H-pyrazolo[3,4-b]pyridine is a significant compound in research and development within the fields of pharmaceuticals and agrochemicals.

Formula: C₆H₄N₄O₂

InChI: InChI=1/C6H4N4O2/c11-10(12)5-1-4-2-8-9-6(4)7-3-5/h1-3H,(H,7,8,9)

SMILES: c1c2cn[nH]c2ncc1N(=O)=O

Synonyms:

• 1H-pyrazolo[3,4-b]pyridine, 5-nitro-

5-Nitro-1H-pyrazolo[3,4-b]pyridine

CAS: 63572-73-6

Formula: C₆H₄N₄O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 164.1216

Ref: IN-DA00EIJ7

5-Nitro-1H-Pyrazolo[3,4-B]Pyridine

CAS: 63572-73-6

5-Nitro-1H-Pyrazolo[3,4-B]Pyridine

Purity: 98%

Molecular weight: 164.12g/mol

Ref: 54-OR1011917

5-Nitro-1H-pyrazolo[3,4-b]pyridine

CAS: 63572-73-6

Formula: C₆H₄N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.124

Ref: 10-F093617

5-NITRO-1H-PYRAZOLO[3,4-B]PYRIDINE

CAS: 63572-73-6

Purity: 95%

Molecular weight: 164.1239929

Ref: 10-F794473