CAS 63582-81-0
:6,8-Bis(hydroxymethyl)-11-methyl-4H-oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione
Description:
6,8-Bis(hydroxymethyl)-11-methyl-4H-oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione, with CAS number 63582-81-0, is a complex organic compound characterized by its unique bicyclic structure that incorporates both oxazole and pyridoquinoline moieties. This compound features multiple functional groups, including hydroxymethyl and methyl substituents, which contribute to its chemical reactivity and potential biological activity. The presence of the hydroxymethyl groups suggests that it may participate in hydrogen bonding and could exhibit solubility in polar solvents. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its heterocyclic nature, which is often associated with bioactive properties. Additionally, the specific arrangement of atoms and functional groups may influence its electronic properties, stability, and interaction with biological targets. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and potential applications.
Formula:C16H14N2O5
InChI:InChI=1/C16H14N2O5/c1-17-12(21)2-8(5-19)10-4-11-9(6-20)3-13(22)18-7-23-16(14(10)17)15(11)18/h2-4,19-20H,5-7H2,1H3
Synonyms:- Hydroxynybomycin
- 2H,4H-Oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione, 6,8-bis(hydroxymethyl)-11-methyl-
- 6,8-Bis(hydroxymethyl)-11-methyl-4H-oxazolo[5,4,3-ij]pyrido[3,2-g]quinoline-4,10(11H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Hydroxynybomycin
CAS:Hydroxynybomycin is an antibiotic with activity against Gram-negative bacteria.Formula:C16H14N2O5Color and Shape:SolidMolecular weight:314.293
