CAS 6359-29-1
:6′-(Diethylamino)-3′-hydroxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthene]-2′-carboxylic acid
Description:
6′-(Diethylamino)-3′-hydroxy-3-oxospiro[isobenzofuran-1(3H),9′-[9H]xanthene]-2′-carboxylic acid, with CAS number 6359-29-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a spiro linkage between an isobenzofuran and a xanthene moiety. This compound typically exhibits properties associated with dyes and pigments, often displaying vibrant colors due to its conjugated system, which allows for effective light absorption. It is soluble in organic solvents and may have limited solubility in water, depending on the specific functional groups present. The presence of the diethylamino group suggests potential basicity and the ability to form salts, which can influence its solubility and reactivity. Additionally, the hydroxyl and carboxylic acid functional groups contribute to its potential as a ligand in coordination chemistry and may enhance its biological activity. Overall, this compound is of interest in various fields, including organic synthesis, materials science, and potentially in biological applications due to its structural features.
Formula:C25H21NO6
InChI:InChI=1S/C25H21NO6/c1-3-26(4-2)14-9-10-18-21(11-14)31-22-13-20(27)16(23(28)29)12-19(22)25(18)17-8-6-5-7-15(17)24(30)32-25/h5-13,27H,3-4H2,1-2H3,(H,28,29)
InChI key:InChIKey=LJYFQGHCZXNILU-UHFFFAOYSA-N
SMILES:O=C1OC2(C=3C(OC=4C2=CC=C(N(CC)CC)C4)=CC(O)=C(C(O)=O)C3)C=5C1=CC=CC5
Synonyms:- 3H-Xanthene-2-carboxylic acid, 9-(o-carboxyphenyl)-6-(diethylamino)-3-oxo-
- 6'-(Diethylamino)-3'-hydroxy-3-oxospiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2'-carboxylic acid
- 6'-(diethylamino)-3'-hydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthene]-2'-carboxylic acid
- Acid Chrome Pink 3BM
- Acid Mordant Pink 3BM
- Basolan Chrome Brilliant Red 3BB
- Einecs 228-797-2
- Spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2'-carboxylic acid, 6'-
- Spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-2'-carboxylic acid, 6'-(diethylamino)-3'-hydroxy-3-oxo-
- Sunchromine Brilliant Red B
- C.I. 45305
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-2'-carboxylic acid,6'-(diethylamino)-3'-hydroxy-3-oxo-
CAS:Formula:C25H21NO6Molecular weight:431.4373
