CAS 63597-73-9
:cis-3-(2,2-Dibromovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid
Description:
Cis-3-(2,2-Dibromovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid is a chemical compound characterized by its unique cyclopropane structure, which includes a carboxylic acid functional group and a dibromovinyl substituent. This compound is notable for its stereochemistry, specifically the cis configuration, which influences its reactivity and interactions with biological systems. The presence of the dibromovinyl group introduces significant polarity and potential for halogen-related reactivity, making it of interest in synthetic organic chemistry. The cyclopropane ring contributes to the compound's strain and rigidity, affecting its overall stability and reactivity. Additionally, the carboxylic acid group imparts acidic properties, allowing for potential participation in acid-base reactions. This compound may have applications in various fields, including pharmaceuticals and agrochemicals, due to its structural features that can influence biological activity. However, specific safety and handling considerations should be taken into account, as halogenated compounds can exhibit toxicity and environmental persistence.
Formula:C8H10Br2O2
InChI:InChI=1/C8H10Br2O2/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3,(H,11,12)/t4-,6-/s2
InChI key:InChIKey=MDIQXIJPQWLFSD-APVHJGEINA-N
SMILES:C(O)(=O)[C@H]1[C@@H](C=C(Br)Br)C1(C)C
Synonyms:- (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid
- (±)-Dibromo-cis-cypermethric acid
- 3-(2,2-Dibromovinyl)-2,2-Dimethylcyclopropane-1-Carboxylic Acid
- Cyclopropanecarboxylic Acid, 3-(2,2-Dibromoethenyl)-2,2-Dimethyl-
- Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (1R,3R)-rel-
- Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, cis-
- cis-(±)-Dibromocypermethric acid
- cis-2,2-Dimethyl-3-(2,2-dibromovinyl)cyclopropanecarboxylic acid
- cis-3-(2,2-Dibromovinyl)-2,2-dimethylcyclopropane-1-carboxylic acid
- cis-3-(2,2-Dibromovinyl)-2,2-dimethylcyclopropanecarboxylic acid
- cis-<span class="text-smallcaps">DL</span>-3-(2,2-Dibromovinyl)-2,2-dimethylcyclopropanecarboxylic acid
- cis-Decamethrinic acid
- rel-(1R,3R)-3-(2,2-Dibromoethenyl)-2,2-dimethylcyclopropanecarboxylic acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
cis-Dibromocypermethric acid 100 µg/mL in Acetonitrile
CAS:Formula:C8H10Br2O2Color and Shape:ColourlessMolecular weight:297.97cis-Dibromocypermethric acid 10 µg/mL in Methanol
CAS:Controlled ProductFormula:C8H10Br2O2Color and Shape:Single SolutionMolecular weight:297.97
