![(4aS,6S,8aS)-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one oxime](https://static.cymitquimica.com/cas-image/30839-4as-6s-8as-6-methoxy-2-phenyl-4a-678a-tetrahydro-4h-pyrano-32-d-13-dioxin-8-one-oxime.png)
CAS 63598-32-3: (4aS,6S,8aS)-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one oxime
Description:The chemical substance known as "(4aS,6S,8aS)-6-methoxy-2-phenyl-4a,6,7,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxin-8-one oxime" with CAS number 63598-32-3 is a complex organic compound characterized by its unique structural features, including a pyran ring fused with a dioxin moiety. This compound contains multiple stereocenters, which contribute to its specific three-dimensional configuration and potentially influence its biological activity. The presence of a methoxy group and a phenyl group suggests that it may exhibit interesting chemical reactivity and interactions, particularly in organic synthesis or medicinal chemistry. The oxime functional group indicates potential for reactivity, particularly in nucleophilic addition reactions. Additionally, the compound's stereochemistry may play a crucial role in its pharmacological properties, making it a candidate for further investigation in drug development or as a lead compound in medicinal chemistry. Overall, this substance exemplifies the complexity and diversity of organic compounds, particularly those with potential therapeutic applications.
Formula:C14H17NO5
InChI:InChI=1/C14H17NO5/c1-17-12-7-10(15-16)13-11(19-12)8-18-14(20-13)9-5-3-2-4-6-9/h2-6,11-14,16H,7-8H2,1H3/b15-10-/t11-,12-,13-,14?/m0/s1
Methyl 4,6-O-Benzylidene-2-deoxy-α-D-erythro-hexopyranosid-3-ulose Oxime
Ref: 3B-M2081
| 1g | 246.00 € |
Methyl 4,6-O-Benzylidene-2-deoxy-α-D-erythro-hexopyranosid-3-ulose Oxime
Ref: IN-DA003RU8
| 1g | 249.00 € |
Methyl 4,6-O-Benzylidene-2-deoxy-±-D-erythro-hexopyranosid-3-ulose Oxime
Ref: 3D-NCA59832
| 1g | 817.00 € | ||
| 2g | 1,303.00 € | ||
| 100mg | 331.00 € | ||
| 250mg | 358.00 € | ||
| 500mg | 517.00 € |
