CAS 63598-36-7
:4,6-O-benzylidene-D-glucal
Description:
4,6-O-benzylidene-D-glucal is a chemical compound that belongs to the class of glucals, which are unsaturated derivatives of sugars. This compound features a benzylidene group at the 4 and 6 positions of the D-glucal structure, contributing to its unique reactivity and properties. It is typically characterized by its ability to undergo various chemical transformations, including reactions typical of aldehydes and alkenes due to the presence of the double bond in the glucal structure. The benzylidene moiety enhances its stability and solubility in organic solvents, making it useful in synthetic organic chemistry, particularly in glycosylation reactions and as an intermediate in the synthesis of more complex carbohydrates. Additionally, 4,6-O-benzylidene-D-glucal can exhibit specific optical activity, which is a characteristic feature of many sugar derivatives. Its applications may extend to medicinal chemistry and the development of glycosylated compounds, highlighting its significance in both academic research and industrial applications.
Formula:C13H14O4
InChI:InChI=1/C13H14O4/c14-10-6-7-15-11-8-16-13(17-12(10)11)9-4-2-1-3-5-9/h1-7,10-14H,8H2/t10-,11-,12+,13?/m1/s1
Synonyms:- 1,5-anhydro-2-deoxy-4,6-O-(phenylmethylidene)-D-arabino-hex-1-enitol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4,6-O-Benzylidene-D-glucal
CAS:Glucal is a carbohydrate that is used as a synthon in organic synthesis. It has been shown to be anomeric and can be synthesized by acetylation of the corresponding aldose, or by the glycosidic bond reaction with borohydride reduction. Glucal is not stable at high pH and can undergo ring-opening reactions with nucleophiles such as sodium borohydride. Glucal also reacts with glycoconjugates to form new molecules, which are called glycosidic products.
Formula:C13H14O4Purity:Min. 95%Color and Shape:White PowderMolecular weight:234.25 g/mol

