CAS 63598-46-9

1-Azetidineacetic acid, 3-[[(2E)-(hydroxyimino)(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, (αR,3S)-

Description:

1-Azetidineacetic acid, 3-[[(2E)-(hydroxyimino)(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, (αR,3S)-, is a complex organic compound characterized by its azetidine ring structure, which contributes to its unique chemical properties. This compound features multiple functional groups, including an amino group, hydroxyl groups, and a ketone, which enhance its reactivity and potential biological activity. The presence of the hydroxyimino group suggests that it may participate in various chemical reactions, such as condensation or nucleophilic addition. The stereochemistry indicated by the (αR,3S)- notation implies specific spatial arrangements of atoms, which can influence the compound's interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural complexity and the presence of phenolic groups that can engage in hydrogen bonding and other interactions. Overall, its unique structure and functional groups make it a subject of interest for further research in chemical and biological applications.

Formula: C₁₉H₁₇N₃O₇

InChI: InChI=1S/C19H17N3O7/c23-12-5-1-10(2-6-12)15(21-29)17(25)20-14-9-22(18(14)26)16(19(27)28)11-3-7-13(24)8-4-11/h1-8,14,16,23-24,29H,9H2,(H,20,25)(H,27,28)/b21-15+/t14-,16+/m0/s1

InChI key: InChIKey=NMMOYDKOFASOBV-ORWLQXDRSA-N

SMILES: [C@@H](C(O)=O)(N1C(=O)[C@@H](NC(/C(=N/O)/C2=CC=C(O)C=C2)=O)C1)C3=CC=C(O)C=C3

Synonyms:

• (2R)-[(3S)-3-{[(2E)-2-(hydroxyimino)-2-(4-hydroxyphenyl)acetyl]amino}-2-oxoazetidin-1-yl](4-hydroxyphenyl)ethanoic acid
• (2R)-[(3S)-3-{[(2Z)-2-(hydroxyimino)-2-(4-hydroxyphenyl)acetyl]amino}-2-oxoazetidin-1-yl](4-hydroxyphenyl)ethanoic acid
• 1-Azetidineacetic acid, 3-[[(2E)-(hydroxyimino)(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, (αR,3S)-
• 1-Azetidineacetic acid, 3-[[(hydroxyimino)(4-hydroxyphenyl)acetyl]amino]-α-(4-hydroxyphenyl)-2-oxo-, [3S-[1(S*),3R*(E)]]-
• Nocardicin F

Nocardicin F

CAS: 63598-46-9

Nocardicin F is a beta-lactam antibiotic, which is derived from various actinomycetes strains. As an antimicrobial compound, its mode of action involves the inhibition of bacterial cell wall synthesis. Specifically, Nocardicin F interferes with the transpeptidation reaction, which is crucial for the cross-linking of peptidoglycan layers. This inhibition leads to a weakened bacterial cell wall, culminating in lysis and cell death, particularly affecting gram-negative bacteria.

Formula: C₁₉H₁₇N₃O₇

Purity: Min. 95%

Molecular weight: 399.4 g/mol

Ref: 3D-NCA59846