CAS 636-20-4

D-desthiobiotin

Description:

D-desthiobiotin, with the CAS number 636-20-4, is a biotin analog that plays a significant role in biochemical research, particularly in studies related to enzyme activity and protein interactions. It is characterized by its structural similarity to biotin, lacking the sulfur atom in the thiophene ring, which makes it a useful tool for studying biotin-dependent enzymes. D-desthiobiotin is typically a white to off-white solid and is soluble in water and various organic solvents, making it versatile for laboratory applications. Its primary function in research is as a competitive inhibitor of biotin-dependent enzymes, allowing scientists to investigate the mechanisms of these enzymes and their biological pathways. Additionally, D-desthiobiotin can be utilized in affinity labeling and bioconjugation techniques, enhancing its utility in the development of biotechnological applications. Overall, its unique properties and functional capabilities make D-desthiobiotin an important compound in the field of biochemistry and molecular biology.

Formula: C₁₀H₁₈N₂O₃

InChI: InChI=1/C10H18N2O3/c1-7-8(12-10(15)11-7)5-3-2-4-6-9(13)14/h7-8H,2-6H2,1H3,(H,13,14)(H2,11,12,15)/t7-,8+/m1/s1

Synonyms:

• 6-[(4S,5R)-5-methyl-2-oxoimidazolidin-4-yl]hexanoic acid

rac-Desthio Biotin

Controlled Product

CAS: 636-20-4

Formula: C₁₀H₁₈N₂O₃

Color and Shape: Neat

Molecular weight: 214.262

Ref: TR-D297490